C30H40N4O3S — CID 46234221
8-(benzenesulfonyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 46234221) has the molecular formula C30H40N4O3S and a molecular weight of 536.74 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-(benzenesulfonyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 46234221 |
| Molecular Formula | C30H40N4O3S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 8-(benzenesulfonyl)-2-[4-[4-[(2S)-2-methylpyrrolidin-1-yl]piperidin-1-yl]phenyl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | C[C@H]1CCCN1C1CCN(c2ccc(N3CCC4(CCN(S(=O)(=O)c5ccccc5)CC4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C30H40N4O3S/c1-24-6-5-18-33(24)27-13-19-31(20-14-27)25-9-11-26(12-10-25)34-23-17-30(29(34)35)15-21-32(22-16-30)38(36,37)28-7-3-2-4-8-28/h2-4,7-12,24,27H,5-6,13-23H2,1H3/t24-/m0/s1 |
| InChIKey | JYGAXAVLOAJTOP-DEOSSOPVSA-N |
| XLogP | 4.35 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|