C27H28F2O4 — CID 23138043
2-[4-[2-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]-5-phenylpentyl]phenyl]acetic acid (PubChem CID 23138043) has the molecular formula C27H28F2O4 and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[4-[2-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]-5-phenylpentyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]-5-phenylpentyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 23138043 |
| Molecular Formula | C27H28F2O4 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[4-[2-[[4-(difluoromethoxy)phenyl]-hydroxymethyl]-5-phenylpentyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CC(CCCc2ccccc2)C(O)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H28F2O4/c28-27(29)33-24-15-13-22(14-16-24)26(32)23(8-4-7-19-5-2-1-3-6-19)17-20-9-11-21(12-10-20)18-25(30)31/h1-3,5-6,9-16,23,26-27,32H,4,7-8,17-18H2,(H,30,31) |
| InChIKey | MUHMWDGVVSMQCK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |