C17H19ClN4O3S2 — CID 23139638
4-ethoxy-3-(1-methyl-3-propyl-7-sulfanylidene-4H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonyl chloride (PubChem CID 23139638) has the molecular formula C17H19ClN4O3S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-ethoxy-3-(1-methyl-3-propyl-7-sulfanylidene-4H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonyl chloride.
| Compound Name | 4-ethoxy-3-(1-methyl-3-propyl-7-sulfanylidene-4H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 23139638 |
| Molecular Formula | C17H19ClN4O3S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 4-ethoxy-3-(1-methyl-3-propyl-7-sulfanylidene-4H-pyrazolo[4,5-d]pyrimidin-5-yl)benzenesulfonyl chloride |
| SMILES | CCCc1nn(C)c2c(=S)nc(-c3cc(S(=O)(=O)Cl)ccc3OCC)[nH]c12 |
| InChI | InChI=1S/C17H19ClN4O3S2/c1-4-6-12-14-15(22(3)21-12)17(26)20-16(19-14)11-9-10(27(18,23)24)7-8-13(11)25-5-2/h7-9H,4-6H2,1-3H3,(H,19,20,26) |
| InChIKey | VLXMCAKSJJKKTL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|