C17H20BrClN4O3S — CID 90833028
3-(7-bromo-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxybenzenesulfonyl chloride (PubChem CID 90833028) has the molecular formula C17H20BrClN4O3S and a molecular weight of 475.80 g/mol. Its IUPAC name is 3-(7-bromo-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxybenzenesulfonyl chloride.
| Compound Name | 3-(7-bromo-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 90833028 |
| Molecular Formula | C17H20BrClN4O3S |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 3-(7-bromo-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidin-5-yl)-4-ethoxybenzenesulfonyl chloride |
| SMILES | CCCc1nn(C)c2c1NC(c1cc(S(=O)(=O)Cl)ccc1OCC)=NC2Br |
| InChI | InChI=1S/C17H20BrClN4O3S/c1-4-6-12-14-15(23(3)22-12)16(18)21-17(20-14)11-9-10(27(19,24)25)7-8-13(11)26-5-2/h7-9,16H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | UIROHGAFQXTZOB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|