C22H31ClN6O3S — CID 90972117
7-chloro-5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine (PubChem CID 90972117) has the molecular formula C22H31ClN6O3S and a molecular weight of 495.05 g/mol. Its IUPAC name is 7-chloro-5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine.
| Compound Name | 7-chloro-5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 90972117 |
| Molecular Formula | C22H31ClN6O3S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 7-chloro-5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4,7-dihydropyrazolo[4,5-d]pyrimidine |
| SMILES | CCCc1nn(C)c2c1NC(c1cc(S(=O)(=O)N3CCN(C)CC3)ccc1OCC)=NC2Cl |
| InChI | InChI=1S/C22H31ClN6O3S/c1-5-7-17-19-20(28(4)26-17)21(23)25-22(24-19)16-14-15(8-9-18(16)32-6-2)33(30,31)29-12-10-27(3)11-13-29/h8-9,14,21H,5-7,10-13H2,1-4H3,(H,24,25) |
| InChIKey | UMUQGLZKUXTOSU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|