C21H27N3O2 — CID 23140494
N-(4-ethoxyphenyl)-3-(N-propylanilino)azetidine-1-carboxamide (PubChem CID 23140494) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-(N-propylanilino)azetidine-1-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-3-(N-propylanilino)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 23140494 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-(N-propylanilino)azetidine-1-carboxamide |
| SMILES | CCCN(c1ccccc1)C1CN(C(=O)Nc2ccc(OCC)cc2)C1 |
| InChI | InChI=1S/C21H27N3O2/c1-3-14-24(18-8-6-5-7-9-18)19-15-23(16-19)21(25)22-17-10-12-20(13-11-17)26-4-2/h5-13,19H,3-4,14-16H2,1-2H3,(H,22,25) |
| InChIKey | MQUJLAVWSLDUNJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |