C46H44N2O4 — CID 23140850
N,N'-bis[2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]oxamide (PubChem CID 23140850) has the molecular formula C46H44N2O4 and a molecular weight of 688.87 g/mol. Its IUPAC name is N,N'-bis[2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]oxamide.
| Compound Name | N,N'-bis[2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 23140850 |
| Molecular Formula | C46H44N2O4 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.33 |
| IUPAC Name | N,N'-bis[2-hydroxy-2,2-bis(4-methylphenyl)-1-phenylethyl]oxamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(NC(=O)C(=O)NC(c2ccccc2)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H44N2O4/c1-31-15-23-37(24-16-31)45(51,38-25-17-32(2)18-26-38)41(35-11-7-5-8-12-35)47-43(49)44(50)48-42(36-13-9-6-10-14-36)46(52,39-27-19-33(3)20-28-39)40-29-21-34(4)22-30-40/h5-30,41-42,51-52H,1-4H3,(H,47,49)(H,48,50) |
| InChIKey | PRCNODDVEBFASK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|