C43H54N2O4 — CID 23140855
N,N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]propanediamide (PubChem CID 23140855) has the molecular formula C43H54N2O4 and a molecular weight of 662.91 g/mol. Its IUPAC name is N,N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]propanediamide.
| Compound Name | N,N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]propanediamide |
|---|---|
| PubChem CID | 23140855 |
| Molecular Formula | C43H54N2O4 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | N,N'-bis[1-hydroxy-4-methyl-1,1-bis(4-methylphenyl)pentan-2-yl]propanediamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(CC(C)C)NC(=O)CC(=O)NC(CC(C)C)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H54N2O4/c1-28(2)25-38(42(48,34-17-9-30(5)10-18-34)35-19-11-31(6)12-20-35)44-40(46)27-41(47)45-39(26-29(3)4)43(49,36-21-13-32(7)14-22-36)37-23-15-33(8)16-24-37/h9-24,28-29,38-39,48-49H,25-27H2,1-8H3,(H,44,46)(H,45,47) |
| InChIKey | FGRJBQDJFDBTIA-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|