C41H50N2O4 — CID 23140858
N,N'-bis[1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]propanediamide (PubChem CID 23140858) has the molecular formula C41H50N2O4 and a molecular weight of 634.86 g/mol. Its IUPAC name is N,N'-bis[1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]propanediamide.
| Compound Name | N,N'-bis[1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]propanediamide |
|---|---|
| PubChem CID | 23140858 |
| Molecular Formula | C41H50N2O4 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | N,N'-bis[1-hydroxy-3-methyl-1,1-bis(4-methylphenyl)butan-2-yl]propanediamide |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(NC(=O)CC(=O)NC(C(C)C)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C41H50N2O4/c1-26(2)38(40(46,32-17-9-28(5)10-18-32)33-19-11-29(6)12-20-33)42-36(44)25-37(45)43-39(27(3)4)41(47,34-21-13-30(7)14-22-34)35-23-15-31(8)16-24-35/h9-24,26-27,38-39,46-47H,25H2,1-8H3,(H,42,44)(H,43,45) |
| InChIKey | KUBKAUXGZLUWJG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|