C39H46N2O4 — CID 23140893
N,N'-bis(1-hydroxy-3,3-dimethyl-1,1-diphenylbutan-2-yl)propanediamide (PubChem CID 23140893) has the molecular formula C39H46N2O4 and a molecular weight of 606.81 g/mol. Its IUPAC name is N,N'-bis(1-hydroxy-3,3-dimethyl-1,1-diphenylbutan-2-yl)propanediamide.
| Compound Name | N,N'-bis(1-hydroxy-3,3-dimethyl-1,1-diphenylbutan-2-yl)propanediamide |
|---|---|
| PubChem CID | 23140893 |
| Molecular Formula | C39H46N2O4 |
| Molecular Weight | 606.81 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | N,N'-bis(1-hydroxy-3,3-dimethyl-1,1-diphenylbutan-2-yl)propanediamide |
| SMILES | CC(C)(C)C(NC(=O)CC(=O)NC(C(C)(C)C)C(O)(c1ccccc1)c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H46N2O4/c1-36(2,3)34(38(44,28-19-11-7-12-20-28)29-21-13-8-14-22-29)40-32(42)27-33(43)41-35(37(4,5)6)39(45,30-23-15-9-16-24-30)31-25-17-10-18-26-31/h7-26,34-35,44-45H,27H2,1-6H3,(H,40,42)(H,41,43) |
| InChIKey | BTLIOBXKWGKTPM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.81 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|