C26H41N — CID 23142754
1-butyl-4-[2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]azepane (PubChem CID 23142754) has the molecular formula C26H41N and a molecular weight of 367.62 g/mol. Its IUPAC name is 1-butyl-4-[2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]azepane.
| Compound Name | 1-butyl-4-[2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]azepane |
|---|---|
| PubChem CID | 23142754 |
| Molecular Formula | C26H41N |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | 1-butyl-4-[2-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]azepane |
| SMILES | CCCCN1CCCC(c2ccccc2C2=CC(C)(C)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C26H41N/c1-6-7-15-27-16-10-11-21(14-17-27)23-12-8-9-13-24(23)22-18-25(2,3)20-26(4,5)19-22/h8-9,12-13,18,21H,6-7,10-11,14-17,19-20H2,1-5H3 |
| InChIKey | WCQXLFXUETWIJI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |