C23H20N4O3 — CID 23143493
ethyl 5-(5-phenylmethoxy-2-pyridinyl)-1-pyridin-2-ylpyrazole-3-carboxylate (PubChem CID 23143493) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is ethyl 5-(5-phenylmethoxy-2-pyridinyl)-1-pyridin-2-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(5-phenylmethoxy-2-pyridinyl)-1-pyridin-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 23143493 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 5-(5-phenylmethoxy-2-pyridinyl)-1-pyridin-2-ylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(OCc3ccccc3)cn2)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C23H20N4O3/c1-2-29-23(28)20-14-21(27(26-20)22-10-6-7-13-24-22)19-12-11-18(15-25-19)30-16-17-8-4-3-5-9-17/h3-15H,2,16H2,1H3 |
| InChIKey | YIVWLYMLYOBAOQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |