C25H22N4O4 — CID 46094004
ethyl 5-[3-[(3-methoxybenzoyl)amino]phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate (PubChem CID 46094004) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is ethyl 5-[3-[(3-methoxybenzoyl)amino]phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[(3-methoxybenzoyl)amino]phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46094004 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | ethyl 5-[3-[(3-methoxybenzoyl)amino]phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3cccc(OC)c3)c2)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C25H22N4O4/c1-3-33-25(31)21-16-22(29(28-21)23-12-4-5-13-26-23)17-8-6-10-19(14-17)27-24(30)18-9-7-11-20(15-18)32-2/h4-16H,3H2,1-2H3,(H,27,30) |
| InChIKey | GTSYRUYZVRNWMQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |