C27H25N3O4 — CID 46094228
ethyl 1-(4-methoxyphenyl)-5-[3-[(4-methylbenzoyl)amino]phenyl]pyrazole-3-carboxylate (PubChem CID 46094228) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 1-(4-methoxyphenyl)-5-[3-[(4-methylbenzoyl)amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-methoxyphenyl)-5-[3-[(4-methylbenzoyl)amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46094228 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl 1-(4-methoxyphenyl)-5-[3-[(4-methylbenzoyl)amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3ccc(C)cc3)c2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C27H25N3O4/c1-4-34-27(32)24-17-25(30(29-24)22-12-14-23(33-3)15-13-22)20-6-5-7-21(16-20)28-26(31)19-10-8-18(2)9-11-19/h5-17H,4H2,1-3H3,(H,28,31) |
| InChIKey | SATRGCUAFSRWAT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |