C25H17F4N3O3 — CID 46094373
ethyl 1-(4-fluorophenyl)-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate (PubChem CID 46094373) has the molecular formula C25H17F4N3O3 and a molecular weight of 483.42 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46094373 |
| Molecular Formula | C25H17F4N3O3 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-5-[3-[(2,3,5-trifluorobenzoyl)amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3cc(F)cc(F)c3F)c2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H17F4N3O3/c1-2-35-25(34)21-13-22(32(31-21)18-8-6-15(26)7-9-18)14-4-3-5-17(10-14)30-24(33)19-11-16(27)12-20(28)23(19)29/h3-13H,2H2,1H3,(H,30,33) |
| InChIKey | YLPLTBDYLCWNMB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|