C26H20N4O3S — CID 46094175
ethyl 5-[3-(1-benzothiophene-3-carbonylamino)phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate (PubChem CID 46094175) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is ethyl 5-[3-(1-benzothiophene-3-carbonylamino)phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-(1-benzothiophene-3-carbonylamino)phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46094175 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | ethyl 5-[3-(1-benzothiophene-3-carbonylamino)phenyl]-1-pyridin-2-ylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3csc4ccccc34)c2)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C26H20N4O3S/c1-2-33-26(32)21-15-22(30(29-21)24-12-5-6-13-27-24)17-8-7-9-18(14-17)28-25(31)20-16-34-23-11-4-3-10-19(20)23/h3-16H,2H2,1H3,(H,28,31) |
| InChIKey | BPCXVGZBNUHYNT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |