C25H21ClN4O3 — CID 46094332
ethyl 5-[3-[(2-chloropyridine-3-carbonyl)amino]phenyl]-1-(2-methylphenyl)pyrazole-3-carboxylate (PubChem CID 46094332) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is ethyl 5-[3-[(2-chloropyridine-3-carbonyl)amino]phenyl]-1-(2-methylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[(2-chloropyridine-3-carbonyl)amino]phenyl]-1-(2-methylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46094332 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethyl 5-[3-[(2-chloropyridine-3-carbonyl)amino]phenyl]-1-(2-methylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(NC(=O)c3cccnc3Cl)c2)n(-c2ccccc2C)n1 |
| InChI | InChI=1S/C25H21ClN4O3/c1-3-33-25(32)20-15-22(30(29-20)21-12-5-4-8-16(21)2)17-9-6-10-18(14-17)28-24(31)19-11-7-13-27-23(19)26/h4-15H,3H2,1-2H3,(H,28,31) |
| InChIKey | LJQVEUOGOULACU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|