C19H18ClN3O4S — CID 23145248
3-(2-chlorophenoxy)-5-[(6-ethylsulfonyl-3-pyridinyl)oxy]benzene-1,2-diamine (PubChem CID 23145248) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-5-[(6-ethylsulfonyl-3-pyridinyl)oxy]benzene-1,2-diamine.
| Compound Name | 3-(2-chlorophenoxy)-5-[(6-ethylsulfonyl-3-pyridinyl)oxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 23145248 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 3-(2-chlorophenoxy)-5-[(6-ethylsulfonyl-3-pyridinyl)oxy]benzene-1,2-diamine |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc(N)c(N)c(Oc3ccccc3Cl)c2)cn1 |
| InChI | InChI=1S/C19H18ClN3O4S/c1-2-28(24,25)18-8-7-12(11-23-18)26-13-9-15(21)19(22)17(10-13)27-16-6-4-3-5-14(16)20/h3-11H,2,21-22H2,1H3 |
| InChIKey | SUHIXNUGLNLKFH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|