About CID 23146452
CID 23146452 (PubChem CID 23146452) has the molecular formula C11H16BrO2Si
and a molecular weight of 288.24 g/mol.
Molecular Properties
| Compound Name | CID 23146452 |
| PubChem CID | 23146452 |
| Molecular Formula | C11H16BrO2Si |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)c1ccccc1CBr |
| InChI | InChI=1S/C11H16BrO2Si/c1-3-13-15(14-4-2)11-8-6-5-7-10(11)9-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | JHPBGVYQTHUVGP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23146452 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23146452?
The IUPAC name of CID 23146452 (CID 23146452) is not available.
What is the SMILES notation for CID 23146452?
The canonical SMILES for CID 23146452 is CCO[Si](OCC)c1ccccc1CBr.
What is the InChIKey of CID 23146452?
The InChIKey is JHPBGVYQTHUVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrO2Si/c1-3-13-15(14-4-2)11-8-6-5-7-10(11)9-12/h5-8H,3-4,9H2,1-2H3.
What are the key properties of CID 23146452?
CID 23146452 has a molecular weight of 288.24 g/mol, XLogP of 2.35, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23146452 is sourced from PubChem (CID 23146452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).