C17H16O5 — CID 23146991
methyl 2-(3-acetylphenyl)-2-(3,5-dihydroxyphenyl)acetate (PubChem CID 23146991) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl 2-(3-acetylphenyl)-2-(3,5-dihydroxyphenyl)acetate.
| Compound Name | methyl 2-(3-acetylphenyl)-2-(3,5-dihydroxyphenyl)acetate |
|---|---|
| PubChem CID | 23146991 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 2-(3-acetylphenyl)-2-(3,5-dihydroxyphenyl)acetate |
| SMILES | COC(=O)C(c1cc(O)cc(O)c1)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C17H16O5/c1-10(18)11-4-3-5-12(6-11)16(17(21)22-2)13-7-14(19)9-15(20)8-13/h3-9,16,19-20H,1-2H3 |
| InChIKey | CPASWEHUUZRSTD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |