About (1-hexylindol-5-yl) hypobromite
(1-hexylindol-5-yl) hypobromite (PubChem CID 23151412) has the molecular formula C14H18BrNO
and a molecular weight of 296.21 g/mol. Its IUPAC name is (1-hexylindol-5-yl) hypobromite.
Molecular Properties
| Compound Name | (1-hexylindol-5-yl) hypobromite |
| PubChem CID | 23151412 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (1-hexylindol-5-yl) hypobromite |
| SMILES | CCCCCCn1ccc2cc(OBr)ccc21 |
| InChI | InChI=1S/C14H18BrNO/c1-2-3-4-5-9-16-10-8-12-11-13(17-15)6-7-14(12)16/h6-8,10-11H,2-5,9H2,1H3 |
| InChIKey | IKSUIXVCDMHCNC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-hexylindol-5-yl) hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hexylindol-5-yl) hypobromite?
The IUPAC name of (1-hexylindol-5-yl) hypobromite (CID 23151412) is (1-hexylindol-5-yl) hypobromite.
What is the SMILES notation for (1-hexylindol-5-yl) hypobromite?
The canonical SMILES for (1-hexylindol-5-yl) hypobromite is CCCCCCn1ccc2cc(OBr)ccc21.
What is the InChIKey of (1-hexylindol-5-yl) hypobromite?
The InChIKey is IKSUIXVCDMHCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO/c1-2-3-4-5-9-16-10-8-12-11-13(17-15)6-7-14(12)16/h6-8,10-11H,2-5,9H2,1H3.
What are the key properties of (1-hexylindol-5-yl) hypobromite?
(1-hexylindol-5-yl) hypobromite has a molecular weight of 296.21 g/mol, XLogP of 4.91, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hexylindol-5-yl) hypobromite is sourced from PubChem (CID 23151412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).