About (1-octylindol-5-yl) hypobromite
(1-octylindol-5-yl) hypobromite (PubChem CID 23151417) has the molecular formula C16H22BrNO
and a molecular weight of 324.26 g/mol. Its IUPAC name is (1-octylindol-5-yl) hypobromite.
Molecular Properties
| Compound Name | (1-octylindol-5-yl) hypobromite |
| PubChem CID | 23151417 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (1-octylindol-5-yl) hypobromite |
| SMILES | CCCCCCCCn1ccc2cc(OBr)ccc21 |
| InChI | InChI=1S/C16H22BrNO/c1-2-3-4-5-6-7-11-18-12-10-14-13-15(19-17)8-9-16(14)18/h8-10,12-13H,2-7,11H2,1H3 |
| InChIKey | FIDVRZMCWPNLSP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-octylindol-5-yl) hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-octylindol-5-yl) hypobromite?
The IUPAC name of (1-octylindol-5-yl) hypobromite (CID 23151417) is (1-octylindol-5-yl) hypobromite.
What is the SMILES notation for (1-octylindol-5-yl) hypobromite?
The canonical SMILES for (1-octylindol-5-yl) hypobromite is CCCCCCCCn1ccc2cc(OBr)ccc21.
What is the InChIKey of (1-octylindol-5-yl) hypobromite?
The InChIKey is FIDVRZMCWPNLSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO/c1-2-3-4-5-6-7-11-18-12-10-14-13-15(19-17)8-9-16(14)18/h8-10,12-13H,2-7,11H2,1H3.
What are the key properties of (1-octylindol-5-yl) hypobromite?
(1-octylindol-5-yl) hypobromite has a molecular weight of 324.26 g/mol, XLogP of 5.69, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-octylindol-5-yl) hypobromite is sourced from PubChem (CID 23151417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).