About ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride
ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride (PubChem CID 23151474) has the molecular formula C8H12Cl2N2O2
and a molecular weight of 239.10 g/mol. Its IUPAC name is ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride |
| PubChem CID | 23151474 |
| Molecular Formula | C8H12Cl2N2O2 |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1=C(NN=C1CCl)C.Cl |
| InChI | InChI=1S/C8H11ClN2O2.ClH/c1-3-13-8(12)7-5(2)10-11-6(7)4-9;/h3-4H2,1-2H3,(H,10,11);1H |
| InChIKey | LOMIGXIUTFJSRH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 55.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 189 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride?
The IUPAC name of ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride (CID 23151474) is ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate;hydrochloride.
What is the SMILES notation for ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride?
The canonical SMILES for ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride is CCOC(=O)C1=C(NN=C1CCl)C.Cl.
What is the InChIKey of ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride?
The InChIKey is LOMIGXIUTFJSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O2.ClH/c1-3-13-8(12)7-5(2)10-11-6(7)4-9;/h3-4H2,1-2H3,(H,10,11);1H.
What are the key properties of ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride?
ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride has a molecular weight of 239.10 g/mol, XLogP of not available, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(chloromethyl)-5-methyl-1H-pyrazole-4-carboxylate hydrochloride is sourced from PubChem (CID 23151474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).