C15H21O7P — CID 23152149
(2,4,6-trimethylphenyl) 2-(2-phosphonooxyethoxymethyl)prop-2-enoate (PubChem CID 23152149) has the molecular formula C15H21O7P and a molecular weight of 344.30 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2-(2-phosphonooxyethoxymethyl)prop-2-enoate.
| Compound Name | (2,4,6-trimethylphenyl) 2-(2-phosphonooxyethoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 23152149 |
| Molecular Formula | C15H21O7P |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2-(2-phosphonooxyethoxymethyl)prop-2-enoate |
| SMILES | C=C(COCCOP(=O)(O)O)C(=O)Oc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H21O7P/c1-10-7-11(2)14(12(3)8-10)22-15(16)13(4)9-20-5-6-21-23(17,18)19/h7-8H,4-6,9H2,1-3H3,(H2,17,18,19) |
| InChIKey | FRZHTSSCDYUVEY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|