C20H17N5O7 — CID 2315647
2-[3-methyl-5-[(4-nitrobenzoyl)amino]pyrazol-1-yl]ethyl 4-nitrobenzoate (PubChem CID 2315647) has the molecular formula C20H17N5O7 and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-[3-methyl-5-[(4-nitrobenzoyl)amino]pyrazol-1-yl]ethyl 4-nitrobenzoate.
| Compound Name | 2-[3-methyl-5-[(4-nitrobenzoyl)amino]pyrazol-1-yl]ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 2315647 |
| Molecular Formula | C20H17N5O7 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[3-methyl-5-[(4-nitrobenzoyl)amino]pyrazol-1-yl]ethyl 4-nitrobenzoate |
| SMILES | Cc1cc(NC(=O)c2ccc([N+](=O)[O-])cc2)n(CCOC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H17N5O7/c1-13-12-18(21-19(26)14-2-6-16(7-3-14)24(28)29)23(22-13)10-11-32-20(27)15-4-8-17(9-5-15)25(30)31/h2-9,12H,10-11H2,1H3,(H,21,26) |
| InChIKey | JQDQJQNJWGXABZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 159.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|