C17H24ClN2O4+ — CID 2315684
[(1R,2S)-2-[2-(4-chloro-3-nitrophenyl)acetyl]oxycyclohexyl]methyl-dimethylazanium (PubChem CID 2315684) has the molecular formula C17H24ClN2O4+ and a molecular weight of 355.84 g/mol. Its IUPAC name is [(1R,2S)-2-[2-(4-chloro-3-nitrophenyl)acetyl]oxycyclohexyl]methyl-dimethylazanium.
| Compound Name | [(1R,2S)-2-[2-(4-chloro-3-nitrophenyl)acetyl]oxycyclohexyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 2315684 |
| Molecular Formula | C17H24ClN2O4+ |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [(1R,2S)-2-[2-(4-chloro-3-nitrophenyl)acetyl]oxycyclohexyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)C[C@H]1CCCC[C@@H]1OC(=O)Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-19(2)11-13-5-3-4-6-16(13)24-17(21)10-12-7-8-14(18)15(9-12)20(22)23/h7-9,13,16H,3-6,10-11H2,1-2H3/p+1/t13-,16+/m1/s1 |
| InChIKey | NKTVEIOKRCFGBI-CJNGLKHVSA-O |
| XLogP | 2.04 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|