C15H15ClN2O5 — CID 95347372
(4-chloro-3-nitrophenyl)methyl (3S)-1-cyclopropyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 95347372) has the molecular formula C15H15ClN2O5 and a molecular weight of 338.75 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)methyl (3S)-1-cyclopropyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-chloro-3-nitrophenyl)methyl (3S)-1-cyclopropyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 95347372 |
| Molecular Formula | C15H15ClN2O5 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (4-chloro-3-nitrophenyl)methyl (3S)-1-cyclopropyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)c([N+](=O)[O-])c1)[C@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C15H15ClN2O5/c16-12-4-1-9(5-13(12)18(21)22)8-23-15(20)10-6-14(19)17(7-10)11-2-3-11/h1,4-5,10-11H,2-3,6-8H2/t10-/m0/s1 |
| InChIKey | KNWMRDQVPCWKFN-JTQLQIEISA-N |
| XLogP | 2.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|