C24H28N2O2 — CID 23157206
methyl 4-[[3-tert-butyl-5-(2-phenylethyl)pyrazol-1-yl]methyl]benzoate (PubChem CID 23157206) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 4-[[3-tert-butyl-5-(2-phenylethyl)pyrazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-tert-butyl-5-(2-phenylethyl)pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 23157206 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl 4-[[3-tert-butyl-5-(2-phenylethyl)pyrazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2nc(C(C)(C)C)cc2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-24(2,3)22-16-21(15-12-18-8-6-5-7-9-18)26(25-22)17-19-10-13-20(14-11-19)23(27)28-4/h5-11,13-14,16H,12,15,17H2,1-4H3 |
| InChIKey | CGSXHGCNUHQOJR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |