C20H16ClFN4O — CID 23158117
5-[1-(4-chloro-2-fluorophenyl)-5-methyltriazol-4-yl]-2-cyclopropyl-3H-isoindol-1-one (PubChem CID 23158117) has the molecular formula C20H16ClFN4O and a molecular weight of 382.83 g/mol. Its IUPAC name is 5-[1-(4-chloro-2-fluorophenyl)-5-methyltriazol-4-yl]-2-cyclopropyl-3H-isoindol-1-one.
| Compound Name | 5-[1-(4-chloro-2-fluorophenyl)-5-methyltriazol-4-yl]-2-cyclopropyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 23158117 |
| Molecular Formula | C20H16ClFN4O |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 5-[1-(4-chloro-2-fluorophenyl)-5-methyltriazol-4-yl]-2-cyclopropyl-3H-isoindol-1-one |
| SMILES | Cc1c(-c2ccc3c(c2)CN(C2CC2)C3=O)nnn1-c1ccc(Cl)cc1F |
| InChI | InChI=1S/C20H16ClFN4O/c1-11-19(23-24-26(11)18-7-3-14(21)9-17(18)22)12-2-6-16-13(8-12)10-25(20(16)27)15-4-5-15/h2-3,6-9,15H,4-5,10H2,1H3 |
| InChIKey | UTDPQOURXHZLTE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |