C5H6N4O2 — CID 23164597
1H-pyrazole-4,5-dicarboxamide (PubChem CID 23164597) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is 1H-pyrazole-4,5-dicarboxamide.
| Compound Name | 1H-pyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 23164597 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 1H-pyrazole-4,5-dicarboxamide |
| SMILES | NC(=O)c1cn[nH]c1C(N)=O |
| InChI | InChI=1S/C5H6N4O2/c6-4(10)2-1-8-9-3(2)5(7)11/h1H,(H2,6,10)(H2,7,11)(H,8,9) |
| InChIKey | PZJLXGCJHYJOIP-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |