C30H31NO4 — CID 23166601
ethyl (E)-3-hydroxy-5-oxo-7-(1-phenyl-3-propan-2-ylpyrrolo[2,1-a]isoquinolin-2-yl)hept-6-enoate (PubChem CID 23166601) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-5-oxo-7-(1-phenyl-3-propan-2-ylpyrrolo[2,1-a]isoquinolin-2-yl)hept-6-enoate.
| Compound Name | ethyl (E)-3-hydroxy-5-oxo-7-(1-phenyl-3-propan-2-ylpyrrolo[2,1-a]isoquinolin-2-yl)hept-6-enoate |
|---|---|
| PubChem CID | 23166601 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl (E)-3-hydroxy-5-oxo-7-(1-phenyl-3-propan-2-ylpyrrolo[2,1-a]isoquinolin-2-yl)hept-6-enoate |
| SMILES | CCOC(=O)CC(O)CC(=O)/C=C/c1c(-c2ccccc2)c2c3ccccc3ccn2c1C(C)C |
| InChI | InChI=1S/C30H31NO4/c1-4-35-27(34)19-24(33)18-23(32)14-15-26-28(22-11-6-5-7-12-22)30-25-13-9-8-10-21(25)16-17-31(30)29(26)20(2)3/h5-17,20,24,33H,4,18-19H2,1-3H3/b15-14+ |
| InChIKey | GLOPEGJXOIQEKO-CCEZHUSRSA-N |
| XLogP | 6.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|