C13H19NO6S2 — CID 23168887
4-[bis(2-methylsulfonylethyl)amino]benzoic acid (PubChem CID 23168887) has the molecular formula C13H19NO6S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[bis(2-methylsulfonylethyl)amino]benzoic acid.
| Compound Name | 4-[bis(2-methylsulfonylethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 23168887 |
| Molecular Formula | C13H19NO6S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[bis(2-methylsulfonylethyl)amino]benzoic acid |
| SMILES | CS(=O)(=O)CCN(CCS(C)(=O)=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO6S2/c1-21(17,18)9-7-14(8-10-22(2,19)20)12-5-3-11(4-6-12)13(15)16/h3-6H,7-10H2,1-2H3,(H,15,16) |
| InChIKey | BMFOEITYBLAOMW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |