C9H19N3O — CID 23174711
N,N-bis(ethylaminomethyl)prop-2-enamide (PubChem CID 23174711) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N,N-bis(ethylaminomethyl)prop-2-enamide.
| Compound Name | N,N-bis(ethylaminomethyl)prop-2-enamide |
|---|---|
| PubChem CID | 23174711 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N,N-bis(ethylaminomethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CNCC)CNCC |
| InChI | InChI=1S/C9H19N3O/c1-4-9(13)12(7-10-5-2)8-11-6-3/h4,10-11H,1,5-8H2,2-3H3 |
| InChIKey | LZSOYZHJAUFJOR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|