About 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride
3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride (PubChem CID 23187674) has the molecular formula C8H20Cl2N2O2S2
and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride.
Molecular Properties
| Compound Name | 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride |
| PubChem CID | 23187674 |
| Molecular Formula | C8H20Cl2N2O2S2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride |
| SMILES | CSN(SC)C(C)C(=O)OCCCN.Cl.Cl |
| InChI | InChI=1S/C8H18N2O2S2.2ClH/c1-7(10(13-2)14-3)8(11)12-6-4-5-9;;/h7H,4-6,9H2,1-3H3;2*1H |
| InChIKey | AVSUFQULKYRFRY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride?
The IUPAC name of 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride (CID 23187674) is 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride.
What is the SMILES notation for 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride?
The canonical SMILES for 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride is CSN(SC)C(C)C(=O)OCCCN.Cl.Cl.
What is the InChIKey of 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride?
The InChIKey is AVSUFQULKYRFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2S2.2ClH/c1-7(10(13-2)14-3)8(11)12-6-4-5-9;;/h7H,4-6,9H2,1-3H3;2*1H.
What are the key properties of 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride?
3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride has a molecular weight of 311.30 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl 2-[bis(methylsulfanyl)amino]propanoate;dihydrochloride is sourced from PubChem (CID 23187674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).