C15H20F3N — CID 23190792
3-[2-(4-ethylcyclohexyl)ethyl]-2,5,6-trifluoropyridine (PubChem CID 23190792) has the molecular formula C15H20F3N and a molecular weight of 271.33 g/mol. Its IUPAC name is 3-[2-(4-ethylcyclohexyl)ethyl]-2,5,6-trifluoropyridine.
| Compound Name | 3-[2-(4-ethylcyclohexyl)ethyl]-2,5,6-trifluoropyridine |
|---|---|
| PubChem CID | 23190792 |
| Molecular Formula | C15H20F3N |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-[2-(4-ethylcyclohexyl)ethyl]-2,5,6-trifluoropyridine |
| SMILES | CCC1CCC(CCc2cc(F)c(F)nc2F)CC1 |
| InChI | InChI=1S/C15H20F3N/c1-2-10-3-5-11(6-4-10)7-8-12-9-13(16)15(18)19-14(12)17/h9-11H,2-8H2,1H3 |
| InChIKey | VIOBGAFIGZDKCP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|