C26H32ClNO6 — CID 23192883
tert-butyl [[3-[3-(4-chlorophenoxy)phenyl]cyclobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 23192883) has the molecular formula C26H32ClNO6 and a molecular weight of 490.00 g/mol. Its IUPAC name is tert-butyl [[3-[3-(4-chlorophenoxy)phenyl]cyclobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [[3-[3-(4-chlorophenoxy)phenyl]cyclobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 23192883 |
| Molecular Formula | C26H32ClNO6 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | tert-butyl [[3-[3-(4-chlorophenoxy)phenyl]cyclobutyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | CC(C)(C)OC(=O)ON(C(=O)OC(C)(C)C)C1CC(c2cccc(Oc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C26H32ClNO6/c1-25(2,3)32-23(29)28(34-24(30)33-26(4,5)6)20-14-18(15-20)17-8-7-9-22(16-17)31-21-12-10-19(27)11-13-21/h7-13,16,18,20H,14-15H2,1-6H3 |
| InChIKey | RNTAIMIBNPEZKD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|