C23H35NO4 — CID 138666601
tert-butyl N-[[7-[3-(2-hydroxyethoxy)phenyl]-3-bicyclo[3.3.1]nonanyl]methyl]carbamate (PubChem CID 138666601) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl N-[[7-[3-(2-hydroxyethoxy)phenyl]-3-bicyclo[3.3.1]nonanyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[7-[3-(2-hydroxyethoxy)phenyl]-3-bicyclo[3.3.1]nonanyl]methyl]carbamate |
|---|---|
| PubChem CID | 138666601 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | tert-butyl N-[[7-[3-(2-hydroxyethoxy)phenyl]-3-bicyclo[3.3.1]nonanyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CC2CC(C1)CC(c1cccc(OCCO)c1)C2 |
| InChI | InChI=1S/C23H35NO4/c1-23(2,3)28-22(26)24-15-18-10-16-9-17(11-18)13-20(12-16)19-5-4-6-21(14-19)27-8-7-25/h4-6,14,16-18,20,25H,7-13,15H2,1-3H3,(H,24,26) |
| InChIKey | SCTITBUUSIYWPO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |