C26H39NO3 — CID 91096210
tert-butyl N-[2-[3-[3-(1-adamantyl)propoxy]phenyl]ethyl]carbamate (PubChem CID 91096210) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[3-(1-adamantyl)propoxy]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[3-(1-adamantyl)propoxy]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 91096210 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | tert-butyl N-[2-[3-[3-(1-adamantyl)propoxy]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cccc(OCCCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C26H39NO3/c1-25(2,3)30-24(28)27-10-8-19-6-4-7-23(15-19)29-11-5-9-26-16-20-12-21(17-26)14-22(13-20)18-26/h4,6-7,15,20-22H,5,8-14,16-18H2,1-3H3,(H,27,28) |
| InChIKey | QATRMMJPOGRKIJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|