C22H31NO3 — CID 138666603
tert-butyl N-[[2-(3-hydroxyphenyl)-2-adamantyl]methyl]carbamate (PubChem CID 138666603) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is tert-butyl N-[[2-(3-hydroxyphenyl)-2-adamantyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(3-hydroxyphenyl)-2-adamantyl]methyl]carbamate |
|---|---|
| PubChem CID | 138666603 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl N-[[2-(3-hydroxyphenyl)-2-adamantyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(c2cccc(O)c2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H31NO3/c1-21(2,3)26-20(25)23-13-22(16-5-4-6-19(24)12-16)17-8-14-7-15(10-17)11-18(22)9-14/h4-6,12,14-15,17-18,24H,7-11,13H2,1-3H3,(H,23,25) |
| InChIKey | FBYFSFCJUDNSRG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |