C15H20O3 — CID 142258747
tert-butyl (2R)-2-(3-hydroxyphenyl)-2-methylcyclopropane-1-carboxylate (PubChem CID 142258747) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-(3-hydroxyphenyl)-2-methylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(3-hydroxyphenyl)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142258747 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl (2R)-2-(3-hydroxyphenyl)-2-methylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C15H20O3/c1-14(2,3)18-13(17)12-9-15(12,4)10-6-5-7-11(16)8-10/h5-8,12,16H,9H2,1-4H3/t12?,15-/m0/s1 |
| InChIKey | YIMIVEXDQKMITO-CVRLYYSRSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |