About [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate
[3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate (PubChem CID 23196073) has the molecular formula C20H15Cl2NO4
and a molecular weight of 404.25 g/mol. Its IUPAC name is [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate.
Molecular Properties
| Compound Name | [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate |
| PubChem CID | 23196073 |
| Molecular Formula | C20H15Cl2NO4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate |
| SMILES | O=C(OCc1ccc(Cl)cc1)Oc1ncccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2NO4/c21-16-7-3-14(4-8-16)12-25-18-2-1-11-23-19(18)27-20(24)26-13-15-5-9-17(22)10-6-15/h1-11H,12-13H2 |
| InChIKey | MYMHGCDVECQOIT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate?
The IUPAC name of [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate (CID 23196073) is [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate.
What is the SMILES notation for [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate?
The canonical SMILES for [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate is O=C(OCc1ccc(Cl)cc1)Oc1ncccc1OCc1ccc(Cl)cc1.
What is the InChIKey of [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate?
The InChIKey is MYMHGCDVECQOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2NO4/c21-16-7-3-14(4-8-16)12-25-18-2-1-11-23-19(18)27-20(24)26-13-15-5-9-17(22)10-6-15/h1-11H,12-13H2.
What are the key properties of [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate?
[3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate has a molecular weight of 404.25 g/mol, XLogP of 5.68, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-chlorophenyl)methoxy]-2-pyridinyl] (4-chlorophenyl)methyl carbonate is sourced from PubChem (CID 23196073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).