C20H20N2O3 — CID 23200080
4-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione (PubChem CID 23200080) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23200080 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[(4-benzylmorpholin-2-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CC3CN(Cc4ccccc4)CCO3)cccc21 |
| InChI | InChI=1S/C20H20N2O3/c23-19-17-8-4-7-15(18(17)20(24)21-19)11-16-13-22(9-10-25-16)12-14-5-2-1-3-6-14/h1-8,16H,9-13H2,(H,21,23,24) |
| InChIKey | LZLDHVLYKYIYLV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|