C19H20ClNO4 — CID 95553756
5-[[(2S)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]methyl]-2-hydroxybenzoic acid (PubChem CID 95553756) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-[[(2S)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(2S)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 95553756 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-[[(2S)-2-[(2-chlorophenyl)methyl]morpholin-4-yl]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(CN2CCO[C@@H](Cc3ccccc3Cl)C2)ccc1O |
| InChI | InChI=1S/C19H20ClNO4/c20-17-4-2-1-3-14(17)10-15-12-21(7-8-25-15)11-13-5-6-18(22)16(9-13)19(23)24/h1-6,9,15,22H,7-8,10-12H2,(H,23,24)/t15-/m0/s1 |
| InChIKey | OPKILNOGNUQKPA-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |