C18H23NOS — CID 23210590
7-ethoxy-2,4-dipropylthieno[2,3-b]indole (PubChem CID 23210590) has the molecular formula C18H23NOS and a molecular weight of 301.46 g/mol. Its IUPAC name is 7-ethoxy-2,4-dipropylthieno[2,3-b]indole.
| Compound Name | 7-ethoxy-2,4-dipropylthieno[2,3-b]indole |
|---|---|
| PubChem CID | 23210590 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 7-ethoxy-2,4-dipropylthieno[2,3-b]indole |
| SMILES | CCCc1cc2c3cc(OCC)ccc3n(CCC)c2s1 |
| InChI | InChI=1S/C18H23NOS/c1-4-7-14-12-16-15-11-13(20-6-3)8-9-17(15)19(10-5-2)18(16)21-14/h8-9,11-12H,4-7,10H2,1-3H3 |
| InChIKey | VUAVHGAKPWCNGY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |