C8H10BrNO3S — CID 2321418
5-bromo-2-ethoxybenzenesulfonamide (PubChem CID 2321418) has the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. Its IUPAC name is 5-bromo-2-ethoxybenzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 2321418 |
| Molecular Formula | C8H10BrNO3S |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 5-bromo-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H10BrNO3S/c1-2-13-7-4-3-6(9)5-8(7)14(10,11)12/h3-5H,2H2,1H3,(H2,10,11,12) |
| InChIKey | DWEBAXUXUGSGPJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |