C11H14BrNO3S2 — CID 1236384
3-(5-bromo-2-ethoxyphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 1236384) has the molecular formula C11H14BrNO3S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is 3-(5-bromo-2-ethoxyphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 3-(5-bromo-2-ethoxyphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 1236384 |
| Molecular Formula | C11H14BrNO3S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 3-(5-bromo-2-ethoxyphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N1CCSC1 |
| InChI | InChI=1S/C11H14BrNO3S2/c1-2-16-10-4-3-9(12)7-11(10)18(14,15)13-5-6-17-8-13/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | XDLJHFMRYMQYGD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |