C25H29FN4O — CID 23215972
1-(2-fluorophenyl)-3-[3-(1-pentyl-3,4-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl]urea (PubChem CID 23215972) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[3-(1-pentyl-3,4-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[3-(1-pentyl-3,4-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 23215972 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[3-(1-pentyl-3,4-dihydro-2H-pyridin-4-yl)-1H-indol-5-yl]urea |
| SMILES | CCCCCN1C=CC(c2c[nH]c3ccc(NC(=O)Nc4ccccc4F)cc23)CC1 |
| InChI | InChI=1S/C25H29FN4O/c1-2-3-6-13-30-14-11-18(12-15-30)21-17-27-23-10-9-19(16-20(21)23)28-25(31)29-24-8-5-4-7-22(24)26/h4-5,7-11,14,16-18,27H,2-3,6,12-13,15H2,1H3,(H2,28,29,31) |
| InChIKey | OTCUEWNSKWTFHF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|