C12H17NO4S — CID 23218724
2-ethyl-4,5-dihydro-1,3-oxazol-3-ium;4-methylbenzenesulfonate (PubChem CID 23218724) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-ethyl-4,5-dihydro-1,3-oxazol-3-ium;4-methylbenzenesulfonate.
| Compound Name | 2-ethyl-4,5-dihydro-1,3-oxazol-3-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23218724 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-ethyl-4,5-dihydro-1,3-oxazol-3-ium;4-methylbenzenesulfonate |
| SMILES | CCC1=[NH+]CCO1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H9NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-5-6-3-4-7-5/h2-5H,1H3,(H,8,9,10);2-4H2,1H3 |
| InChIKey | ORKBBPFJTYTSSC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|