C20H35NO2 — CID 23220872
1-[(E)-hexadec-4-en-4-yl]pyrrolidine-2,5-dione (PubChem CID 23220872) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 1-[(E)-hexadec-4-en-4-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(E)-hexadec-4-en-4-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23220872 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 1-[(E)-hexadec-4-en-4-yl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCCC/C=C(\CCC)N1C(=O)CCC1=O |
| InChI | InChI=1S/C20H35NO2/c1-3-5-6-7-8-9-10-11-12-13-15-18(14-4-2)21-19(22)16-17-20(21)23/h15H,3-14,16-17H2,1-2H3/b18-15+ |
| InChIKey | BWDOBJXGQMMOBR-OBGWFSINSA-N |
| XLogP | 5.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|