About 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate
2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate (PubChem CID 23221481) has the molecular formula C11H23NO2S
and a molecular weight of 233.38 g/mol. Its IUPAC name is 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate |
| PubChem CID | 23221481 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate |
| SMILES | CCSN(CC(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-6-15-12(7-9(2)3)11(13)14-8-10(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | ZQPDCUPRPKCKTG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate?
The IUPAC name of 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate (CID 23221481) is 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate.
What is the SMILES notation for 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate?
The canonical SMILES for 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate is CCSN(CC(C)C)C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate?
The InChIKey is ZQPDCUPRPKCKTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2S/c1-6-15-12(7-9(2)3)11(13)14-8-10(4)5/h9-10H,6-8H2,1-5H3.
What are the key properties of 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate?
2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate has a molecular weight of 233.38 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-ethylsulfanyl-N-(2-methylpropyl)carbamate is sourced from PubChem (CID 23221481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).